C10H13NO2 — CID 130693755
N-but-3-yn-2-yl-N-methyl-2,3-dihydrofuran-5-carboxamide (PubChem CID 130693755) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is N-but-3-yn-2-yl-N-methyl-2,3-dihydrofuran-5-carboxamide.
| Compound Name | N-but-3-yn-2-yl-N-methyl-2,3-dihydrofuran-5-carboxamide |
|---|---|
| PubChem CID | 130693755 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | N-but-3-yn-2-yl-N-methyl-2,3-dihydrofuran-5-carboxamide |
| SMILES | C#CC(C)N(C)C(=O)C1=CCCO1 |
| InChI | InChI=1S/C10H13NO2/c1-4-8(2)11(3)10(12)9-6-5-7-13-9/h1,6,8H,5,7H2,2-3H3 |
| InChIKey | MZSYCYYFZJXVLJ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|