C10H13NO2 — CID 130627716
N-pent-1-yn-3-yl-2,3-dihydrofuran-5-carboxamide (PubChem CID 130627716) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is N-pent-1-yn-3-yl-2,3-dihydrofuran-5-carboxamide.
| Compound Name | N-pent-1-yn-3-yl-2,3-dihydrofuran-5-carboxamide |
|---|---|
| PubChem CID | 130627716 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | N-pent-1-yn-3-yl-2,3-dihydrofuran-5-carboxamide |
| SMILES | C#CC(CC)NC(=O)C1=CCCO1 |
| InChI | InChI=1S/C10H13NO2/c1-3-8(4-2)11-10(12)9-6-5-7-13-9/h1,6,8H,4-5,7H2,2H3,(H,11,12) |
| InChIKey | KKZCWOXCBUWDCK-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|