C8H9NO2 — CID 126999358
N-prop-2-ynyl-2,3-dihydrofuran-5-carboxamide (PubChem CID 126999358) has the molecular formula C8H9NO2 and a molecular weight of 151.16 g/mol. Its IUPAC name is N-prop-2-ynyl-2,3-dihydrofuran-5-carboxamide.
| Compound Name | N-prop-2-ynyl-2,3-dihydrofuran-5-carboxamide |
|---|---|
| PubChem CID | 126999358 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | N-prop-2-ynyl-2,3-dihydrofuran-5-carboxamide |
| SMILES | C#CCNC(=O)C1=CCCO1 |
| InChI | InChI=1S/C8H9NO2/c1-2-5-9-8(10)7-4-3-6-11-7/h1,4H,3,5-6H2,(H,9,10) |
| InChIKey | OOQJXEMGZDIXRY-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|