C8H10ClNO2 — CID 130662793
N-(2-chloroprop-2-enyl)-2,3-dihydrofuran-5-carboxamide (PubChem CID 130662793) has the molecular formula C8H10ClNO2 and a molecular weight of 187.63 g/mol. Its IUPAC name is N-(2-chloroprop-2-enyl)-2,3-dihydrofuran-5-carboxamide.
| Compound Name | N-(2-chloroprop-2-enyl)-2,3-dihydrofuran-5-carboxamide |
|---|---|
| PubChem CID | 130662793 |
| Molecular Formula | C8H10ClNO2 |
| Molecular Weight | 187.63 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | N-(2-chloroprop-2-enyl)-2,3-dihydrofuran-5-carboxamide |
| SMILES | C=C(Cl)CNC(=O)C1=CCCO1 |
| InChI | InChI=1S/C8H10ClNO2/c1-6(9)5-10-8(11)7-3-2-4-12-7/h3H,1-2,4-5H2,(H,10,11) |
| InChIKey | DIEVDJALFTWUKV-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.63 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |