C8H10Br2N2O — CID 130614708
(2R)-2-amino-2-(3,5-dibromo-4-methyl-2-pyridinyl)ethanol (PubChem CID 130614708) has the molecular formula C8H10Br2N2O and a molecular weight of 309.99 g/mol. Its IUPAC name is (2R)-2-amino-2-(3,5-dibromo-4-methyl-2-pyridinyl)ethanol.
| Compound Name | (2R)-2-amino-2-(3,5-dibromo-4-methyl-2-pyridinyl)ethanol |
|---|---|
| PubChem CID | 130614708 |
| Molecular Formula | C8H10Br2N2O |
| Molecular Weight | 309.99 g/mol |
| Exact Mass | 307.92 |
| IUPAC Name | (2R)-2-amino-2-(3,5-dibromo-4-methyl-2-pyridinyl)ethanol |
| SMILES | Cc1c(Br)cnc([C@@H](N)CO)c1Br |
| InChI | InChI=1S/C8H10Br2N2O/c1-4-5(9)2-12-8(7(4)10)6(11)3-13/h2,6,13H,3,11H2,1H3/t6-/m0/s1 |
| InChIKey | AEABDPFSHYOZIY-LURJTMIESA-N |
| XLogP | 1.91 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.99 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |