C10H11NO2S — CID 130616337
(2S)-6-methylsulfanyl-2,3-dihydro-1H-indole-2-carboxylic acid (PubChem CID 130616337) has the molecular formula C10H11NO2S and a molecular weight of 209.27 g/mol. Its IUPAC name is (2S)-6-methylsulfanyl-2,3-dihydro-1H-indole-2-carboxylic acid.
| Compound Name | (2S)-6-methylsulfanyl-2,3-dihydro-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 130616337 |
| Molecular Formula | C10H11NO2S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | (2S)-6-methylsulfanyl-2,3-dihydro-1H-indole-2-carboxylic acid |
| SMILES | CSc1ccc2c(c1)N[C@H](C(=O)O)C2 |
| InChI | InChI=1S/C10H11NO2S/c1-14-7-3-2-6-4-9(10(12)13)11-8(6)5-7/h2-3,5,9,11H,4H2,1H3,(H,12,13)/t9-/m0/s1 |
| InChIKey | QAVWPKNURBKHOP-VIFPVBQESA-N |
| XLogP | 1.83 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |