C7H11N5 — CID 130618237
4-(azetidin-1-ylmethyl)-1,3,5-triazin-2-amine (PubChem CID 130618237) has the molecular formula C7H11N5 and a molecular weight of 165.20 g/mol. Its IUPAC name is 4-(azetidin-1-ylmethyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-(azetidin-1-ylmethyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 130618237 |
| Molecular Formula | C7H11N5 |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | 4-(azetidin-1-ylmethyl)-1,3,5-triazin-2-amine |
| SMILES | Nc1ncnc(CN2CCC2)n1 |
| InChI | InChI=1S/C7H11N5/c8-7-10-5-9-6(11-7)4-12-2-1-3-12/h5H,1-4H2,(H2,8,9,10,11) |
| InChIKey | FHXSMXPOIWTKBD-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |