C8H11F2N — CID 130621780
1-(4,4-difluorobutan-2-yl)pyrrole (PubChem CID 130621780) has the molecular formula C8H11F2N and a molecular weight of 159.18 g/mol. Its IUPAC name is 1-(4,4-difluorobutan-2-yl)pyrrole.
| Compound Name | 1-(4,4-difluorobutan-2-yl)pyrrole |
|---|---|
| PubChem CID | 130621780 |
| Molecular Formula | C8H11F2N |
| Molecular Weight | 159.18 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | 1-(4,4-difluorobutan-2-yl)pyrrole |
| SMILES | CC(CC(F)F)n1cccc1 |
| InChI | InChI=1S/C8H11F2N/c1-7(6-8(9)10)11-4-2-3-5-11/h2-5,7-8H,6H2,1H3 |
| InChIKey | JSMCOKWCAKYLED-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.18 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |