About 1-hexan-2-ylpyrrole
1-hexan-2-ylpyrrole (PubChem CID 62200835) has the molecular formula C10H17N
and a molecular weight of 151.25 g/mol. Its IUPAC name is 1-hexan-2-ylpyrrole.
Molecular Properties
| Compound Name | 1-hexan-2-ylpyrrole |
| PubChem CID | 62200835 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 1-hexan-2-ylpyrrole |
| SMILES | CCCCC(C)n1cccc1 |
| InChI | InChI=1S/C10H17N/c1-3-4-7-10(2)11-8-5-6-9-11/h5-6,8-10H,3-4,7H2,1-2H3 |
| InChIKey | VYHQLVTUZBANEK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-hexan-2-ylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hexan-2-ylpyrrole?
The IUPAC name of 1-hexan-2-ylpyrrole (CID 62200835) is 1-hexan-2-ylpyrrole.
What is the SMILES notation for 1-hexan-2-ylpyrrole?
The canonical SMILES for 1-hexan-2-ylpyrrole is CCCCC(C)n1cccc1.
What is the InChIKey of 1-hexan-2-ylpyrrole?
The InChIKey is VYHQLVTUZBANEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N/c1-3-4-7-10(2)11-8-5-6-9-11/h5-6,8-10H,3-4,7H2,1-2H3.
What are the key properties of 1-hexan-2-ylpyrrole?
1-hexan-2-ylpyrrole has a molecular weight of 151.25 g/mol, XLogP of 3.24, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hexan-2-ylpyrrole is sourced from PubChem (CID 62200835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).