3-pyrrol-1-ylbutanoyl chloride

C8H10ClNO — CID 54402977

IUPAC3-pyrrol-1-ylbutanoyl chloride
SMILESCC(CC(=O)Cl)n1cccc1
InChIInChI=1S/C8H10ClNO/c1-7(6-8(9)11)10-4-2-3-5-10/h2-5,7H,6H2,1H3
InChIKeyVOSYYKBUVFUVNU-UHFFFAOYSA-N
MW171.63 g/mol
LogP2.20
Rot. Bonds3

About 3-pyrrol-1-ylbutanoyl chloride

3-pyrrol-1-ylbutanoyl chloride (PubChem CID 54402977) has the molecular formula C8H10ClNO and a molecular weight of 171.63 g/mol. Its IUPAC name is 3-pyrrol-1-ylbutanoyl chloride.

Molecular Properties

Compound Name3-pyrrol-1-ylbutanoyl chloride
PubChem CID54402977
Molecular FormulaC8H10ClNO
Molecular Weight171.63 g/mol
Exact Mass171.05
IUPAC Name3-pyrrol-1-ylbutanoyl chloride
SMILESCC(CC(=O)Cl)n1cccc1
InChIInChI=1S/C8H10ClNO/c1-7(6-8(9)11)10-4-2-3-5-10/h2-5,7H,6H2,1H3
InChIKeyVOSYYKBUVFUVNU-UHFFFAOYSA-N
XLogP2.20
TPSA22.00 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500171.63
LogP ≤ 52.20
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 3-pyrrol-1-ylbutanoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-pyrrol-1-ylbutanoyl chloride?
The IUPAC name of 3-pyrrol-1-ylbutanoyl chloride (CID 54402977) is 3-pyrrol-1-ylbutanoyl chloride.
What is the SMILES notation for 3-pyrrol-1-ylbutanoyl chloride?
The canonical SMILES for 3-pyrrol-1-ylbutanoyl chloride is CC(CC(=O)Cl)n1cccc1.
What is the InChIKey of 3-pyrrol-1-ylbutanoyl chloride?
The InChIKey is VOSYYKBUVFUVNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10ClNO/c1-7(6-8(9)11)10-4-2-3-5-10/h2-5,7H,6H2,1H3.
What are the key properties of 3-pyrrol-1-ylbutanoyl chloride?
3-pyrrol-1-ylbutanoyl chloride has a molecular weight of 171.63 g/mol, XLogP of 2.20, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyrrol-1-ylbutanoyl chloride is sourced from PubChem (CID 54402977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).