About 3-pyrrol-1-ylbutanoyl chloride
3-pyrrol-1-ylbutanoyl chloride (PubChem CID 54402977) has the molecular formula C8H10ClNO
and a molecular weight of 171.63 g/mol. Its IUPAC name is 3-pyrrol-1-ylbutanoyl chloride.
Molecular Properties
| Compound Name | 3-pyrrol-1-ylbutanoyl chloride |
| PubChem CID | 54402977 |
| Molecular Formula | C8H10ClNO |
| Molecular Weight | 171.63 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | 3-pyrrol-1-ylbutanoyl chloride |
| SMILES | CC(CC(=O)Cl)n1cccc1 |
| InChI | InChI=1S/C8H10ClNO/c1-7(6-8(9)11)10-4-2-3-5-10/h2-5,7H,6H2,1H3 |
| InChIKey | VOSYYKBUVFUVNU-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.63 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-pyrrol-1-ylbutanoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyrrol-1-ylbutanoyl chloride?
The IUPAC name of 3-pyrrol-1-ylbutanoyl chloride (CID 54402977) is 3-pyrrol-1-ylbutanoyl chloride.
What is the SMILES notation for 3-pyrrol-1-ylbutanoyl chloride?
The canonical SMILES for 3-pyrrol-1-ylbutanoyl chloride is CC(CC(=O)Cl)n1cccc1.
What is the InChIKey of 3-pyrrol-1-ylbutanoyl chloride?
The InChIKey is VOSYYKBUVFUVNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10ClNO/c1-7(6-8(9)11)10-4-2-3-5-10/h2-5,7H,6H2,1H3.
What are the key properties of 3-pyrrol-1-ylbutanoyl chloride?
3-pyrrol-1-ylbutanoyl chloride has a molecular weight of 171.63 g/mol, XLogP of 2.20, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyrrol-1-ylbutanoyl chloride is sourced from PubChem (CID 54402977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).