C7H9BrN2O2 — CID 130621805
(5S)-3-(2-bromoprop-2-enyl)-5-methylimidazolidine-2,4-dione (PubChem CID 130621805) has the molecular formula C7H9BrN2O2 and a molecular weight of 233.06 g/mol. Its IUPAC name is (5S)-3-(2-bromoprop-2-enyl)-5-methylimidazolidine-2,4-dione.
| Compound Name | (5S)-3-(2-bromoprop-2-enyl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 130621805 |
| Molecular Formula | C7H9BrN2O2 |
| Molecular Weight | 233.06 g/mol |
| Exact Mass | 231.98 |
| IUPAC Name | (5S)-3-(2-bromoprop-2-enyl)-5-methylimidazolidine-2,4-dione |
| SMILES | C=C(Br)CN1C(=O)N[C@@H](C)C1=O |
| InChI | InChI=1S/C7H9BrN2O2/c1-4(8)3-10-6(11)5(2)9-7(10)12/h5H,1,3H2,2H3,(H,9,12)/t5-/m0/s1 |
| InChIKey | SFGMULSRLWUVCT-YFKPBYRVSA-N |
| XLogP | 0.84 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.06 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|