C7H12N2O2 — CID 130625744
3,4-dihydro-2H-pyran-2-ylmethylurea (PubChem CID 130625744) has the molecular formula C7H12N2O2 and a molecular weight of 156.19 g/mol. Its IUPAC name is 3,4-dihydro-2H-pyran-2-ylmethylurea.
| Compound Name | 3,4-dihydro-2H-pyran-2-ylmethylurea |
|---|---|
| PubChem CID | 130625744 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | 3,4-dihydro-2H-pyran-2-ylmethylurea |
| SMILES | NC(=O)NCC1CCC=CO1 |
| InChI | InChI=1S/C7H12N2O2/c8-7(10)9-5-6-3-1-2-4-11-6/h2,4,6H,1,3,5H2,(H3,8,9,10) |
| InChIKey | OCSWBOWSYKHQHA-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |