C8H14N2O2 — CID 130657465
1-(3,4-dihydro-2H-pyran-2-ylmethyl)-3-methylurea (PubChem CID 130657465) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-pyran-2-ylmethyl)-3-methylurea.
| Compound Name | 1-(3,4-dihydro-2H-pyran-2-ylmethyl)-3-methylurea |
|---|---|
| PubChem CID | 130657465 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 1-(3,4-dihydro-2H-pyran-2-ylmethyl)-3-methylurea |
| SMILES | CNC(=O)NCC1CCC=CO1 |
| InChI | InChI=1S/C8H14N2O2/c1-9-8(11)10-6-7-4-2-3-5-12-7/h3,5,7H,2,4,6H2,1H3,(H2,9,10,11) |
| InChIKey | KBZJZGHWZPEMNR-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |