C8H14N2O3 — CID 130684409
1-(3,4-dihydro-2H-pyran-2-ylmethyl)-3-methoxyurea (PubChem CID 130684409) has the molecular formula C8H14N2O3 and a molecular weight of 186.21 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-pyran-2-ylmethyl)-3-methoxyurea.
| Compound Name | 1-(3,4-dihydro-2H-pyran-2-ylmethyl)-3-methoxyurea |
|---|---|
| PubChem CID | 130684409 |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | 1-(3,4-dihydro-2H-pyran-2-ylmethyl)-3-methoxyurea |
| SMILES | CONC(=O)NCC1CCC=CO1 |
| InChI | InChI=1S/C8H14N2O3/c1-12-10-8(11)9-6-7-4-2-3-5-13-7/h3,5,7H,2,4,6H2,1H3,(H2,9,10,11) |
| InChIKey | UMSDNYQDGQFFPZ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|