C10H16N2O2 — CID 131162498
1-cyclopropyl-3-(3,4-dihydro-2H-pyran-2-ylmethyl)urea (PubChem CID 131162498) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 1-cyclopropyl-3-(3,4-dihydro-2H-pyran-2-ylmethyl)urea.
| Compound Name | 1-cyclopropyl-3-(3,4-dihydro-2H-pyran-2-ylmethyl)urea |
|---|---|
| PubChem CID | 131162498 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 1-cyclopropyl-3-(3,4-dihydro-2H-pyran-2-ylmethyl)urea |
| SMILES | O=C(NCC1CCC=CO1)NC1CC1 |
| InChI | InChI=1S/C10H16N2O2/c13-10(12-8-4-5-8)11-7-9-3-1-2-6-14-9/h2,6,8-9H,1,3-5,7H2,(H2,11,12,13) |
| InChIKey | GLQUYZKODRONFS-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |