About N-(cyanomethyl)-2-[(N'-methylcarbamimidoyl)amino]acetamide
N-(cyanomethyl)-2-[(N'-methylcarbamimidoyl)amino]acetamide (PubChem CID 130626263) has the molecular formula C6H11N5O
and a molecular weight of 169.19 g/mol. Its IUPAC name is N-(cyanomethyl)-2-[(N'-methylcarbamimidoyl)amino]acetamide.
Molecular Properties
| Compound Name | N-(cyanomethyl)-2-[(N'-methylcarbamimidoyl)amino]acetamide |
| PubChem CID | 130626263 |
| Molecular Formula | C6H11N5O |
| Molecular Weight | 169.19 g/mol |
| Exact Mass | 169.10 |
| IUPAC Name | N-(cyanomethyl)-2-[(N'-methylcarbamimidoyl)amino]acetamide |
| SMILES | C/N=C(\N)NCC(=O)NCC#N |
| InChI | InChI=1S/C6H11N5O/c1-9-6(8)11-4-5(12)10-3-2-7/h3-4H2,1H3,(H,10,12)(H3,8,9,11) |
| InChIKey | IZSUASTUHWTKMO-UHFFFAOYSA-N |
| XLogP | -1.84 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.19 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(cyanomethyl)-2-[(N'-methylcarbamimidoyl)amino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyanomethyl)-2-[(N'-methylcarbamimidoyl)amino]acetamide?
The IUPAC name of N-(cyanomethyl)-2-[(N'-methylcarbamimidoyl)amino]acetamide (CID 130626263) is N-(cyanomethyl)-2-[(N'-methylcarbamimidoyl)amino]acetamide.
What is the SMILES notation for N-(cyanomethyl)-2-[(N'-methylcarbamimidoyl)amino]acetamide?
The canonical SMILES for N-(cyanomethyl)-2-[(N'-methylcarbamimidoyl)amino]acetamide is C/N=C(\N)NCC(=O)NCC#N.
What is the InChIKey of N-(cyanomethyl)-2-[(N'-methylcarbamimidoyl)amino]acetamide?
The InChIKey is IZSUASTUHWTKMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N5O/c1-9-6(8)11-4-5(12)10-3-2-7/h3-4H2,1H3,(H,10,12)(H3,8,9,11).
What are the key properties of N-(cyanomethyl)-2-[(N'-methylcarbamimidoyl)amino]acetamide?
N-(cyanomethyl)-2-[(N'-methylcarbamimidoyl)amino]acetamide has a molecular weight of 169.19 g/mol, XLogP of -1.84, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyanomethyl)-2-[(N'-methylcarbamimidoyl)amino]acetamide is sourced from PubChem (CID 130626263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).