C9H13NO3 — CID 130626703
2-(1,3-dioxan-2-yl)-N-prop-2-ynylacetamide (PubChem CID 130626703) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is 2-(1,3-dioxan-2-yl)-N-prop-2-ynylacetamide.
| Compound Name | 2-(1,3-dioxan-2-yl)-N-prop-2-ynylacetamide |
|---|---|
| PubChem CID | 130626703 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | 2-(1,3-dioxan-2-yl)-N-prop-2-ynylacetamide |
| SMILES | C#CCNC(=O)CC1OCCCO1 |
| InChI | InChI=1S/C9H13NO3/c1-2-4-10-8(11)7-9-12-5-3-6-13-9/h1,9H,3-7H2,(H,10,11) |
| InChIKey | TYPWHFHIKGAWOM-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|