C10H16N2O2 — CID 130626791
4-methyl-N-(2-methyloxan-4-yl)-1,3-oxazol-2-amine (PubChem CID 130626791) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 4-methyl-N-(2-methyloxan-4-yl)-1,3-oxazol-2-amine.
| Compound Name | 4-methyl-N-(2-methyloxan-4-yl)-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 130626791 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 4-methyl-N-(2-methyloxan-4-yl)-1,3-oxazol-2-amine |
| SMILES | Cc1coc(NC2CCOC(C)C2)n1 |
| InChI | InChI=1S/C10H16N2O2/c1-7-6-14-10(11-7)12-9-3-4-13-8(2)5-9/h6,8-9H,3-5H2,1-2H3,(H,11,12) |
| InChIKey | DHPMHENWILNRBN-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |