C10H16N2O2 — CID 131184732
4-[(4-methyl-1,3-oxazol-2-yl)amino]cyclohexan-1-ol (PubChem CID 131184732) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 4-[(4-methyl-1,3-oxazol-2-yl)amino]cyclohexan-1-ol.
| Compound Name | 4-[(4-methyl-1,3-oxazol-2-yl)amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 131184732 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 4-[(4-methyl-1,3-oxazol-2-yl)amino]cyclohexan-1-ol |
| SMILES | Cc1coc(NC2CCC(O)CC2)n1 |
| InChI | InChI=1S/C10H16N2O2/c1-7-6-14-10(11-7)12-8-2-4-9(13)5-3-8/h6,8-9,13H,2-5H2,1H3,(H,11,12) |
| InChIKey | CHOKNIRGONLFOZ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |