C10H15NO2 — CID 130627625
N-(2-methylcyclobutyl)-2,3-dihydrofuran-5-carboxamide (PubChem CID 130627625) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is N-(2-methylcyclobutyl)-2,3-dihydrofuran-5-carboxamide.
| Compound Name | N-(2-methylcyclobutyl)-2,3-dihydrofuran-5-carboxamide |
|---|---|
| PubChem CID | 130627625 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | N-(2-methylcyclobutyl)-2,3-dihydrofuran-5-carboxamide |
| SMILES | CC1CCC1NC(=O)C1=CCCO1 |
| InChI | InChI=1S/C10H15NO2/c1-7-4-5-8(7)11-10(12)9-3-2-6-13-9/h3,7-8H,2,4-6H2,1H3,(H,11,12) |
| InChIKey | HZRNFQODBVMAIM-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |