C7H7ClN2OS — CID 130629090
aziridin-1-yl-(2-chloro-4-methyl-1,3-thiazol-5-yl)methanone (PubChem CID 130629090) has the molecular formula C7H7ClN2OS and a molecular weight of 202.67 g/mol. Its IUPAC name is aziridin-1-yl-(2-chloro-4-methyl-1,3-thiazol-5-yl)methanone.
| Compound Name | aziridin-1-yl-(2-chloro-4-methyl-1,3-thiazol-5-yl)methanone |
|---|---|
| PubChem CID | 130629090 |
| Molecular Formula | C7H7ClN2OS |
| Molecular Weight | 202.67 g/mol |
| Exact Mass | 202.00 |
| IUPAC Name | aziridin-1-yl-(2-chloro-4-methyl-1,3-thiazol-5-yl)methanone |
| SMILES | Cc1nc(Cl)sc1C(=O)N1CC1 |
| InChI | InChI=1S/C7H7ClN2OS/c1-4-5(12-7(8)9-4)6(11)10-2-3-10/h2-3H2,1H3 |
| InChIKey | LVKLVBDKPTVBLS-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 32.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.67 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|