C6H7F4NO2S — CID 130631722
1-ethenylsulfonyl-3,3,4,4-tetrafluoropyrrolidine (PubChem CID 130631722) has the molecular formula C6H7F4NO2S and a molecular weight of 233.19 g/mol. Its IUPAC name is 1-ethenylsulfonyl-3,3,4,4-tetrafluoropyrrolidine.
| Compound Name | 1-ethenylsulfonyl-3,3,4,4-tetrafluoropyrrolidine |
|---|---|
| PubChem CID | 130631722 |
| Molecular Formula | C6H7F4NO2S |
| Molecular Weight | 233.19 g/mol |
| Exact Mass | 233.01 |
| IUPAC Name | 1-ethenylsulfonyl-3,3,4,4-tetrafluoropyrrolidine |
| SMILES | C=CS(=O)(=O)N1CC(F)(F)C(F)(F)C1 |
| InChI | InChI=1S/C6H7F4NO2S/c1-2-14(12,13)11-3-5(7,8)6(9,10)4-11/h2H,1,3-4H2 |
| InChIKey | AEJKFSLEHBEODB-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.19 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|