C6H10F3NO2S — CID 131103092
1-(2,2,2-trifluoroethylsulfonyl)pyrrolidine (PubChem CID 131103092) has the molecular formula C6H10F3NO2S and a molecular weight of 217.21 g/mol. Its IUPAC name is 1-(2,2,2-trifluoroethylsulfonyl)pyrrolidine.
| Compound Name | 1-(2,2,2-trifluoroethylsulfonyl)pyrrolidine |
|---|---|
| PubChem CID | 131103092 |
| Molecular Formula | C6H10F3NO2S |
| Molecular Weight | 217.21 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | 1-(2,2,2-trifluoroethylsulfonyl)pyrrolidine |
| SMILES | O=S(=O)(CC(F)(F)F)N1CCCC1 |
| InChI | InChI=1S/C6H10F3NO2S/c7-6(8,9)5-13(11,12)10-3-1-2-4-10/h1-5H2 |
| InChIKey | LDJQDSGJYMPKTL-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.21 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |