C7H9BrIN3 — CID 130632441
(1S)-1-(6-bromo-5-iodo-2-pyridinyl)ethane-1,2-diamine (PubChem CID 130632441) has the molecular formula C7H9BrIN3 and a molecular weight of 341.98 g/mol. Its IUPAC name is (1S)-1-(6-bromo-5-iodo-2-pyridinyl)ethane-1,2-diamine.
| Compound Name | (1S)-1-(6-bromo-5-iodo-2-pyridinyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 130632441 |
| Molecular Formula | C7H9BrIN3 |
| Molecular Weight | 341.98 g/mol |
| Exact Mass | 340.90 |
| IUPAC Name | (1S)-1-(6-bromo-5-iodo-2-pyridinyl)ethane-1,2-diamine |
| SMILES | NC[C@H](N)c1ccc(I)c(Br)n1 |
| InChI | InChI=1S/C7H9BrIN3/c8-7-4(9)1-2-6(12-7)5(11)3-10/h1-2,5H,3,10-11H2/t5-/m0/s1 |
| InChIKey | MYPGUNLNHAMVEJ-YFKPBYRVSA-N |
| XLogP | 1.41 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.98 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|