C11H18FN — CID 130634845
1-[(1-fluorocyclopropyl)methyl]-3,5-dimethyl-3,6-dihydro-2H-pyridine (PubChem CID 130634845) has the molecular formula C11H18FN and a molecular weight of 183.27 g/mol. Its IUPAC name is 1-[(1-fluorocyclopropyl)methyl]-3,5-dimethyl-3,6-dihydro-2H-pyridine.
| Compound Name | 1-[(1-fluorocyclopropyl)methyl]-3,5-dimethyl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 130634845 |
| Molecular Formula | C11H18FN |
| Molecular Weight | 183.27 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | 1-[(1-fluorocyclopropyl)methyl]-3,5-dimethyl-3,6-dihydro-2H-pyridine |
| SMILES | CC1=CC(C)CN(CC2(F)CC2)C1 |
| InChI | InChI=1S/C11H18FN/c1-9-5-10(2)7-13(6-9)8-11(12)3-4-11/h5,9H,3-4,6-8H2,1-2H3 |
| InChIKey | DWSXIBRSMDDEAH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|