C10H11N3 — CID 130634869
4-[(2-methylcyclopropyl)amino]pyridine-3-carbonitrile (PubChem CID 130634869) has the molecular formula C10H11N3 and a molecular weight of 173.22 g/mol. Its IUPAC name is 4-[(2-methylcyclopropyl)amino]pyridine-3-carbonitrile.
| Compound Name | 4-[(2-methylcyclopropyl)amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 130634869 |
| Molecular Formula | C10H11N3 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | 4-[(2-methylcyclopropyl)amino]pyridine-3-carbonitrile |
| SMILES | CC1CC1Nc1ccncc1C#N |
| InChI | InChI=1S/C10H11N3/c1-7-4-10(7)13-9-2-3-12-6-8(9)5-11/h2-3,6-7,10H,4H2,1H3,(H,12,13) |
| InChIKey | IUURNVLKVOLRHA-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |