C13H15N3 — CID 62397116
5-N-(2-methylcyclopropyl)isoquinoline-5,8-diamine (PubChem CID 62397116) has the molecular formula C13H15N3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 5-N-(2-methylcyclopropyl)isoquinoline-5,8-diamine.
| Compound Name | 5-N-(2-methylcyclopropyl)isoquinoline-5,8-diamine |
|---|---|
| PubChem CID | 62397116 |
| Molecular Formula | C13H15N3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 5-N-(2-methylcyclopropyl)isoquinoline-5,8-diamine |
| SMILES | CC1CC1Nc1ccc(N)c2cnccc12 |
| InChI | InChI=1S/C13H15N3/c1-8-6-13(8)16-12-3-2-11(14)10-7-15-5-4-9(10)12/h2-5,7-8,13,16H,6,14H2,1H3 |
| InChIKey | OHJQSZVKXGODJM-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|