C10H16N2S — CID 130635309
1-cyclopent-3-en-1-yl-3-(2-methylprop-2-enyl)thiourea (PubChem CID 130635309) has the molecular formula C10H16N2S and a molecular weight of 196.32 g/mol. Its IUPAC name is 1-cyclopent-3-en-1-yl-3-(2-methylprop-2-enyl)thiourea.
| Compound Name | 1-cyclopent-3-en-1-yl-3-(2-methylprop-2-enyl)thiourea |
|---|---|
| PubChem CID | 130635309 |
| Molecular Formula | C10H16N2S |
| Molecular Weight | 196.32 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 1-cyclopent-3-en-1-yl-3-(2-methylprop-2-enyl)thiourea |
| SMILES | C=C(C)CNC(=S)NC1CC=CC1 |
| InChI | InChI=1S/C10H16N2S/c1-8(2)7-11-10(13)12-9-5-3-4-6-9/h3-4,9H,1,5-7H2,2H3,(H2,11,12,13) |
| InChIKey | CFWCTELRTSXTDS-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.32 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|