C8H16N2OS — CID 130636579
1-[(2R)-2-hydroxypropyl]-3-(1-methylcyclopropyl)thiourea (PubChem CID 130636579) has the molecular formula C8H16N2OS and a molecular weight of 188.30 g/mol. Its IUPAC name is 1-[(2R)-2-hydroxypropyl]-3-(1-methylcyclopropyl)thiourea.
| Compound Name | 1-[(2R)-2-hydroxypropyl]-3-(1-methylcyclopropyl)thiourea |
|---|---|
| PubChem CID | 130636579 |
| Molecular Formula | C8H16N2OS |
| Molecular Weight | 188.30 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | 1-[(2R)-2-hydroxypropyl]-3-(1-methylcyclopropyl)thiourea |
| SMILES | C[C@@H](O)CNC(=S)NC1(C)CC1 |
| InChI | InChI=1S/C8H16N2OS/c1-6(11)5-9-7(12)10-8(2)3-4-8/h6,11H,3-5H2,1-2H3,(H2,9,10,12)/t6-/m1/s1 |
| InChIKey | KFQKSWIVJWRLRI-ZCFIWIBFSA-N |
| XLogP | 0.38 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.30 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|