C11H14BrNO — CID 130637839
2-[(6-bromo-2,3-dihydro-1H-inden-5-yl)amino]ethanol (PubChem CID 130637839) has the molecular formula C11H14BrNO and a molecular weight of 256.14 g/mol. Its IUPAC name is 2-[(6-bromo-2,3-dihydro-1H-inden-5-yl)amino]ethanol.
| Compound Name | 2-[(6-bromo-2,3-dihydro-1H-inden-5-yl)amino]ethanol |
|---|---|
| PubChem CID | 130637839 |
| Molecular Formula | C11H14BrNO |
| Molecular Weight | 256.14 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | 2-[(6-bromo-2,3-dihydro-1H-inden-5-yl)amino]ethanol |
| SMILES | OCCNc1cc2c(cc1Br)CCC2 |
| InChI | InChI=1S/C11H14BrNO/c12-10-6-8-2-1-3-9(8)7-11(10)13-4-5-14/h6-7,13-14H,1-5H2 |
| InChIKey | PQDKMHPOIYVRJT-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.14 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |