C10H14N2O2 — CID 54041165
N-[3-(hydroxyamino)-5,6,7,8-tetrahydronaphthalen-2-yl]hydroxylamine (PubChem CID 54041165) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is N-[3-(hydroxyamino)-5,6,7,8-tetrahydronaphthalen-2-yl]hydroxylamine.
| Compound Name | N-[3-(hydroxyamino)-5,6,7,8-tetrahydronaphthalen-2-yl]hydroxylamine |
|---|---|
| PubChem CID | 54041165 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | N-[3-(hydroxyamino)-5,6,7,8-tetrahydronaphthalen-2-yl]hydroxylamine |
| SMILES | ONc1cc2c(cc1NO)CCCC2 |
| InChI | InChI=1S/C10H14N2O2/c13-11-9-5-7-3-1-2-4-8(7)6-10(9)12-14/h5-6,11-14H,1-4H2 |
| InChIKey | LMLJCBMFSBGVEE-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|