C12H18N2O2 — CID 54337349
2-N,3-N-dimethoxy-5,6,7,8-tetrahydronaphthalene-2,3-diamine (PubChem CID 54337349) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 2-N,3-N-dimethoxy-5,6,7,8-tetrahydronaphthalene-2,3-diamine.
| Compound Name | 2-N,3-N-dimethoxy-5,6,7,8-tetrahydronaphthalene-2,3-diamine |
|---|---|
| PubChem CID | 54337349 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 2-N,3-N-dimethoxy-5,6,7,8-tetrahydronaphthalene-2,3-diamine |
| SMILES | CONc1cc2c(cc1NOC)CCCC2 |
| InChI | InChI=1S/C12H18N2O2/c1-15-13-11-7-9-5-3-4-6-10(9)8-12(11)14-16-2/h7-8,13-14H,3-6H2,1-2H3 |
| InChIKey | TWKVCYCWYXKHGI-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|