C7H13NO4S — CID 130638996
N-[(3R,4S)-4-hydroxyoxolan-3-yl]cyclopropanesulfonamide (PubChem CID 130638996) has the molecular formula C7H13NO4S and a molecular weight of 207.25 g/mol. Its IUPAC name is N-[(3R,4S)-4-hydroxyoxolan-3-yl]cyclopropanesulfonamide.
| Compound Name | N-[(3R,4S)-4-hydroxyoxolan-3-yl]cyclopropanesulfonamide |
|---|---|
| PubChem CID | 130638996 |
| Molecular Formula | C7H13NO4S |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | N-[(3R,4S)-4-hydroxyoxolan-3-yl]cyclopropanesulfonamide |
| SMILES | O=S(=O)(N[C@@H]1COC[C@H]1O)C1CC1 |
| InChI | InChI=1S/C7H13NO4S/c9-7-4-12-3-6(7)8-13(10,11)5-1-2-5/h5-9H,1-4H2/t6-,7-/m1/s1 |
| InChIKey | BOVGNOUKXMEMRQ-RNFRBKRXSA-N |
| XLogP | -1.17 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |