C5H12N2O4S — CID 130671824
(3S,4R)-4-(methylsulfamoylamino)oxolan-3-ol (PubChem CID 130671824) has the molecular formula C5H12N2O4S and a molecular weight of 196.23 g/mol. Its IUPAC name is (3S,4R)-4-(methylsulfamoylamino)oxolan-3-ol.
| Compound Name | (3S,4R)-4-(methylsulfamoylamino)oxolan-3-ol |
|---|---|
| PubChem CID | 130671824 |
| Molecular Formula | C5H12N2O4S |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | (3S,4R)-4-(methylsulfamoylamino)oxolan-3-ol |
| SMILES | CNS(=O)(=O)N[C@@H]1COC[C@H]1O |
| InChI | InChI=1S/C5H12N2O4S/c1-6-12(9,10)7-4-2-11-3-5(4)8/h4-8H,2-3H2,1H3/t4-,5-/m1/s1 |
| InChIKey | PIPWMAIDWJDHSB-RFZPGFLSSA-N |
| XLogP | -2.20 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |