About N-[(3S,4R)-4-(3-methylbut-2-enoxy)oxan-3-yl]cyclopropanesulfonamide
N-[(3S,4R)-4-(3-methylbut-2-enoxy)oxan-3-yl]cyclopropanesulfonamide (PubChem CID 133266066) has the molecular formula C13H23NO4S
and a molecular weight of 289.40 g/mol. Its IUPAC name is N-[(3S,4R)-4-(3-methylbut-2-enoxy)oxan-3-yl]cyclopropanesulfonamide.
Molecular Properties
| Compound Name | N-[(3S,4R)-4-(3-methylbut-2-enoxy)oxan-3-yl]cyclopropanesulfonamide |
| PubChem CID | 133266066 |
| Molecular Formula | C13H23NO4S |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | N-[(3S,4R)-4-(3-methylbut-2-enoxy)oxan-3-yl]cyclopropanesulfonamide |
| SMILES | CC(C)=CCO[C@@H]1CCOC[C@@H]1NS(=O)(=O)C1CC1 |
| InChI | InChI=1S/C13H23NO4S/c1-10(2)5-8-18-13-6-7-17-9-12(13)14-19(15,16)11-3-4-11/h5,11-14H,3-4,6-9H2,1-2H3/t12-,13+/m0/s1 |
| InChIKey | VGCRYZROJKKECG-QWHCGFSZSA-N |
| XLogP | 1.21 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(3S,4R)-4-(3-methylbut-2-enoxy)oxan-3-yl]cyclopropanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3S,4R)-4-(3-methylbut-2-enoxy)oxan-3-yl]cyclopropanesulfonamide?
The IUPAC name of N-[(3S,4R)-4-(3-methylbut-2-enoxy)oxan-3-yl]cyclopropanesulfonamide (CID 133266066) is N-[(3S,4R)-4-(3-methylbut-2-enoxy)oxan-3-yl]cyclopropanesulfonamide.
What is the SMILES notation for N-[(3S,4R)-4-(3-methylbut-2-enoxy)oxan-3-yl]cyclopropanesulfonamide?
The canonical SMILES for N-[(3S,4R)-4-(3-methylbut-2-enoxy)oxan-3-yl]cyclopropanesulfonamide is CC(C)=CCO[C@@H]1CCOC[C@@H]1NS(=O)(=O)C1CC1.
What is the InChIKey of N-[(3S,4R)-4-(3-methylbut-2-enoxy)oxan-3-yl]cyclopropanesulfonamide?
The InChIKey is VGCRYZROJKKECG-QWHCGFSZSA-N. The full InChI is InChI=1S/C13H23NO4S/c1-10(2)5-8-18-13-6-7-17-9-12(13)14-19(15,16)11-3-4-11/h5,11-14H,3-4,6-9H2,1-2H3/t12-,13+/m0/s1.
What are the key properties of N-[(3S,4R)-4-(3-methylbut-2-enoxy)oxan-3-yl]cyclopropanesulfonamide?
N-[(3S,4R)-4-(3-methylbut-2-enoxy)oxan-3-yl]cyclopropanesulfonamide has a molecular weight of 289.40 g/mol, XLogP of 1.21, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3S,4R)-4-(3-methylbut-2-enoxy)oxan-3-yl]cyclopropanesulfonamide is sourced from PubChem (CID 133266066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).