C18H27N3O3 — CID 91782561
N,N-dimethyl-6-[[(3R,4S)-4-(3-methylbut-2-enoxy)oxan-3-yl]amino]pyridine-2-carboxamide (PubChem CID 91782561) has the molecular formula C18H27N3O3 and a molecular weight of 333.43 g/mol. Its IUPAC name is N,N-dimethyl-6-[[(3R,4S)-4-(3-methylbut-2-enoxy)oxan-3-yl]amino]pyridine-2-carboxamide.
| Compound Name | N,N-dimethyl-6-[[(3R,4S)-4-(3-methylbut-2-enoxy)oxan-3-yl]amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 91782561 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | N,N-dimethyl-6-[[(3R,4S)-4-(3-methylbut-2-enoxy)oxan-3-yl]amino]pyridine-2-carboxamide |
| SMILES | CC(C)=CCO[C@H]1CCOC[C@H]1Nc1cccc(C(=O)N(C)C)n1 |
| InChI | InChI=1S/C18H27N3O3/c1-13(2)8-11-24-16-9-10-23-12-15(16)20-17-7-5-6-14(19-17)18(22)21(3)4/h5-8,15-16H,9-12H2,1-4H3,(H,19,20)/t15-,16+/m1/s1 |
| InChIKey | SFPDYIRGPHIMJQ-CVEARBPZSA-N |
| XLogP | 2.34 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|