About [4-(1,3,4-thiadiazol-2-yl)-1,4-oxazepan-2-yl]methanamine
[4-(1,3,4-thiadiazol-2-yl)-1,4-oxazepan-2-yl]methanamine (PubChem CID 130640806) has the molecular formula C8H14N4OS
and a molecular weight of 214.29 g/mol. Its IUPAC name is [4-(1,3,4-thiadiazol-2-yl)-1,4-oxazepan-2-yl]methanamine.
Molecular Properties
| Compound Name | [4-(1,3,4-thiadiazol-2-yl)-1,4-oxazepan-2-yl]methanamine |
| PubChem CID | 130640806 |
| Molecular Formula | C8H14N4OS |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | [4-(1,3,4-thiadiazol-2-yl)-1,4-oxazepan-2-yl]methanamine |
| SMILES | NCC1CN(c2nncs2)CCCO1 |
| InChI | InChI=1S/C8H14N4OS/c9-4-7-5-12(2-1-3-13-7)8-11-10-6-14-8/h6-7H,1-5,9H2 |
| InChIKey | JMUSECVFLZOILY-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4-(1,3,4-thiadiazol-2-yl)-1,4-oxazepan-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(1,3,4-thiadiazol-2-yl)-1,4-oxazepan-2-yl]methanamine?
The IUPAC name of [4-(1,3,4-thiadiazol-2-yl)-1,4-oxazepan-2-yl]methanamine (CID 130640806) is [4-(1,3,4-thiadiazol-2-yl)-1,4-oxazepan-2-yl]methanamine.
What is the SMILES notation for [4-(1,3,4-thiadiazol-2-yl)-1,4-oxazepan-2-yl]methanamine?
The canonical SMILES for [4-(1,3,4-thiadiazol-2-yl)-1,4-oxazepan-2-yl]methanamine is NCC1CN(c2nncs2)CCCO1.
What is the InChIKey of [4-(1,3,4-thiadiazol-2-yl)-1,4-oxazepan-2-yl]methanamine?
The InChIKey is JMUSECVFLZOILY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4OS/c9-4-7-5-12(2-1-3-13-7)8-11-10-6-14-8/h6-7H,1-5,9H2.
What are the key properties of [4-(1,3,4-thiadiazol-2-yl)-1,4-oxazepan-2-yl]methanamine?
[4-(1,3,4-thiadiazol-2-yl)-1,4-oxazepan-2-yl]methanamine has a molecular weight of 214.29 g/mol, XLogP of 0.09, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(1,3,4-thiadiazol-2-yl)-1,4-oxazepan-2-yl]methanamine is sourced from PubChem (CID 130640806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).