C9H17N3O — CID 130641286
2-amino-2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethanol (PubChem CID 130641286) has the molecular formula C9H17N3O and a molecular weight of 183.25 g/mol. Its IUPAC name is 2-amino-2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethanol.
| Compound Name | 2-amino-2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethanol |
|---|---|
| PubChem CID | 130641286 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | 2-amino-2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethanol |
| SMILES | CCn1nc(C)c(C(N)CO)c1C |
| InChI | InChI=1S/C9H17N3O/c1-4-12-7(3)9(6(2)11-12)8(10)5-13/h8,13H,4-5,10H2,1-3H3 |
| InChIKey | BHXNUCOUEPTVRE-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |