C9H12ClFN2OS — CID 130643749
3-fluoro-N-thiophen-3-ylpyrrolidine-3-carboxamide;hydrochloride (PubChem CID 130643749) has the molecular formula C9H12ClFN2OS and a molecular weight of 250.73 g/mol. Its IUPAC name is 3-fluoro-N-thiophen-3-ylpyrrolidine-3-carboxamide;hydrochloride.
| Compound Name | 3-fluoro-N-thiophen-3-ylpyrrolidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 130643749 |
| Molecular Formula | C9H12ClFN2OS |
| Molecular Weight | 250.73 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | 3-fluoro-N-thiophen-3-ylpyrrolidine-3-carboxamide;hydrochloride |
| SMILES | Cl.O=C(Nc1ccsc1)C1(F)CCNC1 |
| InChI | InChI=1S/C9H11FN2OS.ClH/c10-9(2-3-11-6-9)8(13)12-7-1-4-14-5-7;/h1,4-5,11H,2-3,6H2,(H,12,13);1H |
| InChIKey | LNAFMGIPOQGAQX-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.73 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |