C9H12FN3OS — CID 118050136
4-fluoro-N-(1,2-thiazol-5-yl)piperidine-4-carboxamide (PubChem CID 118050136) has the molecular formula C9H12FN3OS and a molecular weight of 229.28 g/mol. Its IUPAC name is 4-fluoro-N-(1,2-thiazol-5-yl)piperidine-4-carboxamide.
| Compound Name | 4-fluoro-N-(1,2-thiazol-5-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 118050136 |
| Molecular Formula | C9H12FN3OS |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 4-fluoro-N-(1,2-thiazol-5-yl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccns1)C1(F)CCNCC1 |
| InChI | InChI=1S/C9H12FN3OS/c10-9(2-5-11-6-3-9)8(14)13-7-1-4-12-15-7/h1,4,11H,2-3,5-6H2,(H,13,14) |
| InChIKey | GSTLNGCJTLEFGH-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |