C9H11BrO3S — CID 130645620
3-(5-bromo-4-methylthiophen-2-yl)-3-hydroxy-2-methylpropanoic acid (PubChem CID 130645620) has the molecular formula C9H11BrO3S and a molecular weight of 279.16 g/mol. Its IUPAC name is 3-(5-bromo-4-methylthiophen-2-yl)-3-hydroxy-2-methylpropanoic acid.
| Compound Name | 3-(5-bromo-4-methylthiophen-2-yl)-3-hydroxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 130645620 |
| Molecular Formula | C9H11BrO3S |
| Molecular Weight | 279.16 g/mol |
| Exact Mass | 277.96 |
| IUPAC Name | 3-(5-bromo-4-methylthiophen-2-yl)-3-hydroxy-2-methylpropanoic acid |
| SMILES | Cc1cc(C(O)C(C)C(=O)O)sc1Br |
| InChI | InChI=1S/C9H11BrO3S/c1-4-3-6(14-8(4)10)7(11)5(2)9(12)13/h3,5,7,11H,1-2H3,(H,12,13) |
| InChIKey | LQLYWESZXNBXMI-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.16 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |