C9H8Br2O2 — CID 130646189
2-(3,4-dibromophenyl)-2-methoxyacetaldehyde (PubChem CID 130646189) has the molecular formula C9H8Br2O2 and a molecular weight of 307.97 g/mol. Its IUPAC name is 2-(3,4-dibromophenyl)-2-methoxyacetaldehyde.
| Compound Name | 2-(3,4-dibromophenyl)-2-methoxyacetaldehyde |
|---|---|
| PubChem CID | 130646189 |
| Molecular Formula | C9H8Br2O2 |
| Molecular Weight | 307.97 g/mol |
| Exact Mass | 305.89 |
| IUPAC Name | 2-(3,4-dibromophenyl)-2-methoxyacetaldehyde |
| SMILES | COC(C=O)c1ccc(Br)c(Br)c1 |
| InChI | InChI=1S/C9H8Br2O2/c1-13-9(5-12)6-2-3-7(10)8(11)4-6/h2-5,9H,1H3 |
| InChIKey | QTXPHGJUAZQVDY-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.97 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|