C9H18F2N2 — CID 130653889
1-(4,4-difluorobutan-2-yl)-3-methylpiperazine (PubChem CID 130653889) has the molecular formula C9H18F2N2 and a molecular weight of 192.25 g/mol. Its IUPAC name is 1-(4,4-difluorobutan-2-yl)-3-methylpiperazine.
| Compound Name | 1-(4,4-difluorobutan-2-yl)-3-methylpiperazine |
|---|---|
| PubChem CID | 130653889 |
| Molecular Formula | C9H18F2N2 |
| Molecular Weight | 192.25 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 1-(4,4-difluorobutan-2-yl)-3-methylpiperazine |
| SMILES | CC1CN(C(C)CC(F)F)CCN1 |
| InChI | InChI=1S/C9H18F2N2/c1-7-6-13(4-3-12-7)8(2)5-9(10)11/h7-9,12H,3-6H2,1-2H3 |
| InChIKey | CPTIELNFRRDQNK-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.25 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |