C10H16N2O — CID 130654162
(4aR,7aR)-6-methyl-4-prop-2-ynyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine (PubChem CID 130654162) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is (4aR,7aR)-6-methyl-4-prop-2-ynyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine.
| Compound Name | (4aR,7aR)-6-methyl-4-prop-2-ynyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
|---|---|
| PubChem CID | 130654162 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | (4aR,7aR)-6-methyl-4-prop-2-ynyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
| SMILES | C#CCN1CCO[C@@H]2CN(C)C[C@H]21 |
| InChI | InChI=1S/C10H16N2O/c1-3-4-12-5-6-13-10-8-11(2)7-9(10)12/h1,9-10H,4-8H2,2H3/t9-,10-/m1/s1 |
| InChIKey | ZEZHIARIZFKKOD-NXEZZACHSA-N |
| XLogP | -0.37 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|