C7H15N3O — CID 123450803
6-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-4-amine (PubChem CID 123450803) has the molecular formula C7H15N3O and a molecular weight of 157.22 g/mol. Its IUPAC name is 6-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-4-amine.
| Compound Name | 6-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-4-amine |
|---|---|
| PubChem CID | 123450803 |
| Molecular Formula | C7H15N3O |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.12 |
| IUPAC Name | 6-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-4-amine |
| SMILES | CN1CC2OCCN(N)C2C1 |
| InChI | InChI=1S/C7H15N3O/c1-9-4-6-7(5-9)11-3-2-10(6)8/h6-7H,2-5,8H2,1H3 |
| InChIKey | LCKZDVFETREAPL-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|