C14H26N2O — CID 137455480
4-methyl-2-(2-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl)morpholine (PubChem CID 137455480) has the molecular formula C14H26N2O and a molecular weight of 238.37 g/mol. Its IUPAC name is 4-methyl-2-(2-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl)morpholine.
| Compound Name | 4-methyl-2-(2-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl)morpholine |
|---|---|
| PubChem CID | 137455480 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | 4-methyl-2-(2-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl)morpholine |
| SMILES | CN1CCOC(C2CCCC3CN(C)CC32)C1 |
| InChI | InChI=1S/C14H26N2O/c1-15-6-7-17-14(10-15)12-5-3-4-11-8-16(2)9-13(11)12/h11-14H,3-10H2,1-2H3 |
| InChIKey | FBIWKTIWQAJIIS-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |