C9H14BrNO2 — CID 130654779
N-(4-bromooxolan-3-yl)-2-methylcyclopropane-1-carboxamide (PubChem CID 130654779) has the molecular formula C9H14BrNO2 and a molecular weight of 248.12 g/mol. Its IUPAC name is N-(4-bromooxolan-3-yl)-2-methylcyclopropane-1-carboxamide.
| Compound Name | N-(4-bromooxolan-3-yl)-2-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 130654779 |
| Molecular Formula | C9H14BrNO2 |
| Molecular Weight | 248.12 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | N-(4-bromooxolan-3-yl)-2-methylcyclopropane-1-carboxamide |
| SMILES | CC1CC1C(=O)NC1COCC1Br |
| InChI | InChI=1S/C9H14BrNO2/c1-5-2-6(5)9(12)11-8-4-13-3-7(8)10/h5-8H,2-4H2,1H3,(H,11,12) |
| InChIKey | YVWUUCJGGGQCTM-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.12 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|