C9H14BrNO4 — CID 130751499
N-(4-bromooxolan-3-yl)-1,4-dioxane-2-carboxamide (PubChem CID 130751499) has the molecular formula C9H14BrNO4 and a molecular weight of 280.12 g/mol. Its IUPAC name is N-(4-bromooxolan-3-yl)-1,4-dioxane-2-carboxamide.
| Compound Name | N-(4-bromooxolan-3-yl)-1,4-dioxane-2-carboxamide |
|---|---|
| PubChem CID | 130751499 |
| Molecular Formula | C9H14BrNO4 |
| Molecular Weight | 280.12 g/mol |
| Exact Mass | 279.01 |
| IUPAC Name | N-(4-bromooxolan-3-yl)-1,4-dioxane-2-carboxamide |
| SMILES | O=C(NC1COCC1Br)C1COCCO1 |
| InChI | InChI=1S/C9H14BrNO4/c10-6-3-14-4-7(6)11-9(12)8-5-13-1-2-15-8/h6-8H,1-5H2,(H,11,12) |
| InChIKey | MAWLFQNJWMGSOP-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.12 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|