C8H12N2O3 — CID 130658838
4-[(1S)-1-amino-2-methoxyethyl]-6-hydroxy-1H-pyridin-2-one (PubChem CID 130658838) has the molecular formula C8H12N2O3 and a molecular weight of 184.19 g/mol. Its IUPAC name is 4-[(1S)-1-amino-2-methoxyethyl]-6-hydroxy-1H-pyridin-2-one.
| Compound Name | 4-[(1S)-1-amino-2-methoxyethyl]-6-hydroxy-1H-pyridin-2-one |
|---|---|
| PubChem CID | 130658838 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 4-[(1S)-1-amino-2-methoxyethyl]-6-hydroxy-1H-pyridin-2-one |
| SMILES | COC[C@@H](N)c1cc(O)[nH]c(=O)c1 |
| InChI | InChI=1S/C8H12N2O3/c1-13-4-6(9)5-2-7(11)10-8(12)3-5/h2-3,6H,4,9H2,1H3,(H2,10,11,12)/t6-/m1/s1 |
| InChIKey | RVJAKMLGNATDOO-ZCFIWIBFSA-N |
| XLogP | -0.27 |
| TPSA | 88.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |