C6H10F3NO2S — CID 130662657
N-[2-(trifluoromethyl)cyclobutyl]methanesulfonamide (PubChem CID 130662657) has the molecular formula C6H10F3NO2S and a molecular weight of 217.21 g/mol. Its IUPAC name is N-[2-(trifluoromethyl)cyclobutyl]methanesulfonamide.
| Compound Name | N-[2-(trifluoromethyl)cyclobutyl]methanesulfonamide |
|---|---|
| PubChem CID | 130662657 |
| Molecular Formula | C6H10F3NO2S |
| Molecular Weight | 217.21 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | N-[2-(trifluoromethyl)cyclobutyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NC1CCC1C(F)(F)F |
| InChI | InChI=1S/C6H10F3NO2S/c1-13(11,12)10-5-3-2-4(5)6(7,8)9/h4-5,10H,2-3H2,1H3 |
| InChIKey | WFYWFFOTPCMQFK-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.21 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |